CAS 70030-11-4 appears in our catalog under these names: 3-Hydroxyphenazepam, >95% (HPLC), 3-Hydroxyphenazepam (1.0 mg/mL in Methanol), 3-Hydroxyphenazepam, 3-Hydroxyphenazepam 1.0 mg/ml in Methanol, 3–hydroxy Phenazepam. Offered by: TRC, LoGiCal, GLPBio, MedChemExpress. Available pack sizes: 100mg, 10mg, 1mg, 1x1ml, 1ml, 5mg, 1 mg.
7-bromo-5-(2-chlorophenyl)-3-hydroxy-1,3-dihydro-1,4-benzodiazepin-2-one (CAS 70030-11-4) is a chemical compound with the molecular formula C15H10BrClN2O2 and a molecular weight of 365.61 g/mol. IUPAC name: 7-bromo-5-(2-chlorophenyl)-3-hydroxy-1,3-dihydro-1,4-benzodiazepin-2-one. InChIKey: KRJKJUWAZOWXNV-UHFFFAOYSA-N.
| Molecular formula | C15H10BrClN2O2 |
|---|---|
| Molecular weight | 365.61 g/mol |
| IUPAC name | 7-bromo-5-(2-chlorophenyl)-3-hydroxy-1,3-dihydro-1,4-benzodiazepin-2-one |
| InChIKey | KRJKJUWAZOWXNV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC(C(=O)NC3=C2C=C(C=C3)Br)O)Cl |
Computed by PubChem (NCBI)