Products 700360-05-0

CAS 700360-05-0 is the registry number for 2,4,6-Triisopropyl-2'-methylbiphenyl, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

2-(2-methylphenyl)-1,3,5-tri(propan-2-yl)benzene (CAS 700360-05-0) is a chemical compound with the molecular formula C22H30 and a molecular weight of 294.5 g/mol. IUPAC name: 2-(2-methylphenyl)-1,3,5-tri(propan-2-yl)benzene. InChIKey: XQDPQFCFNWDECK-UHFFFAOYSA-N.

Identity
Molecular formulaC22H30
Molecular weight294.5 g/mol
IUPAC name2-(2-methylphenyl)-1,3,5-tri(propan-2-yl)benzene
InChIKeyXQDPQFCFNWDECK-UHFFFAOYSA-N
SMILESCC1=CC=CC=C1C2=C(C=C(C=C2C(C)C)C(C)C)C(C)C

Computed by PubChem (NCBI)