CAS 70060-21-8 appears in our catalog under these names: 5-Methylthieno(3,2-b)thiophene-2-carboxylic acid, 95%, 5-Methylthieno(3,2-b)thiophene-2-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-methylthieno[3,2-b]thiophene-5-carboxylic acid (CAS 70060-21-8) is a chemical compound with the molecular formula C8H6O2S2 and a molecular weight of 198.3 g/mol. IUPAC name: 2-methylthieno[3,2-b]thiophene-5-carboxylic acid. InChIKey: VOCYXBFIICKEKG-UHFFFAOYSA-N.
| Molecular formula | C8H6O2S2 |
|---|---|
| Molecular weight | 198.3 g/mol |
| IUPAC name | 2-methylthieno[3,2-b]thiophene-5-carboxylic acid |
| InChIKey | VOCYXBFIICKEKG-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(S1)C=C(S2)C(=O)O |
Computed by PubChem (NCBI)