CAS 70061-39-1 is the registry number for 3,4-Dibromo-2,5-dimethylthiophene 1,1-dioxide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3,4-dibromo-2,5-dimethylthiophene 1,1-dioxide (CAS 70061-39-1) is a chemical compound with the molecular formula C6H6Br2O2S and a molecular weight of 301.99 g/mol. IUPAC name: 3,4-dibromo-2,5-dimethylthiophene 1,1-dioxide. InChIKey: CQKFFLZFTZHYDJ-UHFFFAOYSA-N.
| Molecular formula | C6H6Br2O2S |
|---|---|
| Molecular weight | 301.99 g/mol |
| IUPAC name | 3,4-dibromo-2,5-dimethylthiophene 1,1-dioxide |
| InChIKey | CQKFFLZFTZHYDJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(S1(=O)=O)C)Br)Br |
Computed by PubChem (NCBI)