CAS 700853-87-8 appears in our catalog under these names: 3-(2-Furanyl)-1-(methylsulfonyl)-5-(methylthio)-1H-1,2,4-triazole, 98%, 98%, 3-(2-Furanyl)-1-(methylsulfonyl)-5-(methylthio)-1H-1,2,4-triazole, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
3-(furan-2-yl)-5-methylsulfanyl-1-methylsulfonyl-1,2,4-triazole (CAS 700853-87-8) is a chemical compound with the molecular formula C8H9N3O3S2 and a molecular weight of 259.3 g/mol. IUPAC name: 3-(furan-2-yl)-5-methylsulfanyl-1-methylsulfonyl-1,2,4-triazole. InChIKey: BBAJVLDHPYYRCW-UHFFFAOYSA-N.
| Molecular formula | C8H9N3O3S2 |
|---|---|
| Molecular weight | 259.3 g/mol |
| IUPAC name | 3-(furan-2-yl)-5-methylsulfanyl-1-methylsulfonyl-1,2,4-triazole |
| InChIKey | BBAJVLDHPYYRCW-UHFFFAOYSA-N |
| SMILES | CSC1=NC(=NN1S(=O)(=O)C)C2=CC=CO2 |
Computed by PubChem (NCBI)