CAS 7009-49-6 is the registry number for Sodium 2-(1-(hydroxymethyl)cyclohexyl)acetate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Sodium 2-[1-(hydroxymethyl)cyclohexyl]acetate (CAS 7009-49-6) is a chemical compound with the molecular formula C9H15NaO3 and a molecular weight of 194.20 g/mol. IUPAC name: sodium 2-[1-(hydroxymethyl)cyclohexyl]acetate. InChIKey: YPKROQTVZNJPNX-UHFFFAOYSA-M.
| Molecular formula | C9H15NaO3 |
|---|---|
| Molecular weight | 194.20 g/mol |
| IUPAC name | sodium 2-[1-(hydroxymethyl)cyclohexyl]acetate |
| InChIKey | YPKROQTVZNJPNX-UHFFFAOYSA-M |
| SMILES | C1CCC(CC1)(CC(=O)[O-])CO.[Na+] |
Computed by PubChem (NCBI)