CAS 701-72-4 is the registry number for N-Hydroxybenzeneethanimidoyl chloride, >95%, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(1Z)-N-hydroxy-2-phenylethanimidoyl chloride (CAS 701-72-4) is a chemical compound with the molecular formula C8H8ClNO and a molecular weight of 169.61 g/mol. IUPAC name: (1Z)-N-hydroxy-2-phenylethanimidoyl chloride. InChIKey: GZBWRHWHHPBVHE-NTMALXAHSA-N.
| Molecular formula | C8H8ClNO |
|---|---|
| Molecular weight | 169.61 g/mol |
| IUPAC name | (1Z)-N-hydroxy-2-phenylethanimidoyl chloride |
| InChIKey | GZBWRHWHHPBVHE-NTMALXAHSA-N |
| SMILES | C1=CC=C(C=C1)C/C(=N/O)/Cl |
Computed by PubChem (NCBI)