CAS 701255-27-8 is the registry number for 4-Methoxybenzyl 5-bromo-2-chlorobenzamide, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 5g.
5-bromo-2-chloro-N-[(4-methoxyphenyl)methyl]benzamide (CAS 701255-27-8) is a chemical compound with the molecular formula C15H13BrClNO2 and a molecular weight of 354.62 g/mol. IUPAC name: 5-bromo-2-chloro-N-[(4-methoxyphenyl)methyl]benzamide. InChIKey: UGBPFPJQRDBYHO-UHFFFAOYSA-N.
| Molecular formula | C15H13BrClNO2 |
|---|---|
| Molecular weight | 354.62 g/mol |
| IUPAC name | 5-bromo-2-chloro-N-[(4-methoxyphenyl)methyl]benzamide |
| InChIKey | UGBPFPJQRDBYHO-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CNC(=O)C2=C(C=CC(=C2)Br)Cl |
Computed by PubChem (NCBI)