CAS 701260-15-3 is the registry number for Cyclohexyl 5-bromo-2-chlorobenzamide, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 100g, 25g, 5g.
5-bromo-2-chloro-N-cyclohexylbenzamide (CAS 701260-15-3) is a chemical compound with the molecular formula C13H15BrClNO and a molecular weight of 316.62 g/mol. IUPAC name: 5-bromo-2-chloro-N-cyclohexylbenzamide. InChIKey: UZVJVHGWRPJYPW-UHFFFAOYSA-N.
| Molecular formula | C13H15BrClNO |
|---|---|
| Molecular weight | 316.62 g/mol |
| IUPAC name | 5-bromo-2-chloro-N-cyclohexylbenzamide |
| InChIKey | UZVJVHGWRPJYPW-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)NC(=O)C2=C(C=CC(=C2)Br)Cl |
Computed by PubChem (NCBI)