CAS 70146-25-7 is the registry number for Rel-(1R,2R,5R)-5-amino-2-methylcyclohexan-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,2R,5R)-5-amino-2-methylcyclohexan-1-ol (CAS 70146-25-7) is a chemical compound with the molecular formula C7H15NO and a molecular weight of 129.20 g/mol. IUPAC name: (1R,2R,5R)-5-amino-2-methylcyclohexan-1-ol. InChIKey: QVJHLJGPSVCTGC-FSDSQADBSA-N.
| Molecular formula | C7H15NO |
|---|---|
| Molecular weight | 129.20 g/mol |
| IUPAC name | (1R,2R,5R)-5-amino-2-methylcyclohexan-1-ol |
| InChIKey | QVJHLJGPSVCTGC-FSDSQADBSA-N |
| SMILES | C[C@@H]1CC[C@H](C[C@H]1O)N |
Computed by PubChem (NCBI)