CAS 70189-93-4 is the registry number for N-n-butyl-D-glucamine. Offered by: TRC. Available pack sizes: 250mg.
(2R,3R,4R,5S)-6-(butylamino)hexane-1,2,3,4,5-pentol (CAS 70189-93-4) is a chemical compound with the molecular formula C10H23NO5 and a molecular weight of 237.29 g/mol. IUPAC name: (2R,3R,4R,5S)-6-(butylamino)hexane-1,2,3,4,5-pentol. InChIKey: QVEUDPHFUKJQHH-SGIHWFKDSA-N.
| Molecular formula | C10H23NO5 |
|---|---|
| Molecular weight | 237.29 g/mol |
| IUPAC name | (2R,3R,4R,5S)-6-(butylamino)hexane-1,2,3,4,5-pentol |
| InChIKey | QVEUDPHFUKJQHH-SGIHWFKDSA-N |
| SMILES | CCCCNC[C@@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O |
Computed by PubChem (NCBI)