CAS 701906-28-7 is the registry number for 2-Hydrazino-ethan-1,1,2,2-d4-ol. Offered by: TRC. Available pack sizes: 25mg.
1,1,2,2-tetradeuterio-2-hydrazinylethanol (CAS 701906-28-7) is a chemical compound with the molecular formula C2H8N2O and a molecular weight of 80.12 g/mol. IUPAC name: 1,1,2,2-tetradeuterio-2-hydrazinylethanol. InChIKey: GBHCABUWWQUMAJ-LNLMKGTHSA-N.
| Molecular formula | C2H8N2O |
|---|---|
| Molecular weight | 80.12 g/mol |
| IUPAC name | 1,1,2,2-tetradeuterio-2-hydrazinylethanol |
| InChIKey | GBHCABUWWQUMAJ-LNLMKGTHSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])O)NN |
Computed by PubChem (NCBI)