CAS 701920-71-0 is the registry number for 2-Chloro-1-(4a,10a-dihydro-phenothiazin-10-yl)-ethanone, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4a,10a-dihydrophenothiazin-10-yl)-2-chloroethanone (CAS 701920-71-0) is a chemical compound with the molecular formula C14H12ClNOS and a molecular weight of 277.8 g/mol. IUPAC name: 1-(4a,10a-dihydrophenothiazin-10-yl)-2-chloroethanone. InChIKey: MJWFQSVXOXKRRF-UHFFFAOYSA-N.
| Molecular formula | C14H12ClNOS |
|---|---|
| Molecular weight | 277.8 g/mol |
| IUPAC name | 1-(4a,10a-dihydrophenothiazin-10-yl)-2-chloroethanone |
| InChIKey | MJWFQSVXOXKRRF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N(C3C=CC=CC3S2)C(=O)CCl |
Computed by PubChem (NCBI)