Products 701940-17-2
CAS 701940-17-2 is the registry number for (2,3-difluoro-4-methylphenyl)(4-methylpiperazin-1-yl)methanone, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
(2,3-difluoro-4-methylphenyl)-(4-methylpiperazin-1-yl)methanone (CAS 701940-17-2) is a chemical compound with the molecular formula C13H16F2N2O and a molecular weight of 254.28 g/mol. IUPAC name: (2,3-difluoro-4-methylphenyl)-(4-methylpiperazin-1-yl)methanone. InChIKey: NWJYYJXYUFYYDK-UHFFFAOYSA-N.
| Molecular formula | C13H16F2N2O |
|---|---|
| Molecular weight | 254.28 g/mol |
| IUPAC name | (2,3-difluoro-4-methylphenyl)-(4-methylpiperazin-1-yl)methanone |
| InChIKey | NWJYYJXYUFYYDK-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)C(=O)N2CCN(CC2)C)F)F |
Computed by PubChem (NCBI)