Products 702-50-1
CAS 702-50-1 is the registry number for 2,2,5,5-Tetramethyl-1,3-cyclohexanedione. Offered by: TRC, Biosynth. Available pack sizes: 1g, 2,5g, 250mg.
2,2,5,5-tetramethylcyclohexane-1,3-dione (CAS 702-50-1) is a chemical compound with the molecular formula C10H16O2 and a molecular weight of 168.23 g/mol. IUPAC name: 2,2,5,5-tetramethylcyclohexane-1,3-dione. InChIKey: RMYOPLPHLGBSCY-UHFFFAOYSA-N.
| Molecular formula | C10H16O2 |
|---|---|
| Molecular weight | 168.23 g/mol |
| IUPAC name | 2,2,5,5-tetramethylcyclohexane-1,3-dione |
| InChIKey | RMYOPLPHLGBSCY-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)C(C(=O)C1)(C)C)C |
Computed by PubChem (NCBI)
Synonyms:
2,2,5,5-Tetramethyl-1,3-cyclohexanedione, 1,3-Cyclohexanedione, 2,2,5,5-tetramethyl-, Methone, dimethyl-, Medone, dimethyl-, RMYOPLPHLGBSCY-UHFFFAOYSA-N, 2,2,5,5-tetramethylcyclohexane-1,3-dione, 2,2-Dimethyldimedone, 1, 2,2,5,5-tetramethyl-, 2,5,5-Tetramethyl-1,3-cyclohexanedione, 2,?2,?5,?5-?Tetramethyl-1,?3-?cyclohexanedione