Products 7020-50-0
CAS 7020-50-0 is the registry number for Glycyrrhetic Acid Impurity 1. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
3-oxoglycyrrhetinic acid is a pentacyclic triterpenoid. It is functionally related to a glycyrrhetinic acid. It is a conjugate acid of a 3-oxoglycyrrhetinate.
Source: ChEBI
| Molecular formula | C30H44O4 |
|---|---|
| Molecular weight | 468.7 g/mol |
| IUPAC name | (2S,4aS,6aR,6aS,6bR,8aR,12aS,14bR)-2,4a,6a,6b,9,9,12a-heptamethyl-10,13-dioxo-1,3,4,5,6,6a,7,8,8a,11,12,14b-dodecahydropicene-2-carboxylic acid |
| InChIKey | QGWDYPREORDRIT-LPXJIFNVSA-N |
| SMILES | C[C@]12CC[C@](C[C@H]1C3=CC(=O)[C@@H]4[C@]5(CCC(=O)C([C@@H]5CC[C@]4([C@@]3(CC2)C)C)(C)C)C)(C)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-oxoglycyrrhetinic acid, 3,11-dioxoolean-12-en-30-oic acid, 3-oxo glycyrrhetinic acid, (20beta)-3,11-Dioxoolean-12-en-29-oic acid, Glycyrrhetic Acid Impurity 1, (+)-3-Oxoglycyrrhetinic acid, 3,11-Dioxoolean-12-ene-30-oic acid, 3-Oxoglycyrrhetinate; 3-oxoglycyrrhetinic acid, (18beta,20beta)-3,11-Dioxo-olean-12-en-29-oic acid