CAS 70217-01-5 is the registry number for Desethylpropionate Fenoxaprop P. Offered by: TRC. Available pack sizes: 5g.
4-[(6-chloro-1,3-benzoxazol-2-yl)oxy]phenol (CAS 70217-01-5) is a chemical compound with the molecular formula C13H8ClNO3 and a molecular weight of 261.66 g/mol. IUPAC name: 4-[(6-chloro-1,3-benzoxazol-2-yl)oxy]phenol. InChIKey: VMFCMPIPSNBHJH-UHFFFAOYSA-N.
| Molecular formula | C13H8ClNO3 |
|---|---|
| Molecular weight | 261.66 g/mol |
| IUPAC name | 4-[(6-chloro-1,3-benzoxazol-2-yl)oxy]phenol |
| InChIKey | VMFCMPIPSNBHJH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1O)OC2=NC3=C(O2)C=C(C=C3)Cl |
Computed by PubChem (NCBI)