Products 70237-41-1
CAS 70237-41-1 appears in our catalog under these names: N,N-Diisopropylamine-d14, Di-iso-propyl-d14-amine, 98 atom % D, min 98% Chemical Purity. Offered by: TRC, CDN. Available pack sizes: 100mg, 25mg, 50mg, 0,5g, 0,25g.
1,1,1,2,3,3,3-heptadeuterio-N-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)propan-2-amine (CAS 70237-41-1) is a chemical compound with the molecular formula C6H15N and a molecular weight of 115.28 g/mol. IUPAC name: 1,1,1,2,3,3,3-heptadeuterio-N-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)propan-2-amine. InChIKey: UAOMVDZJSHZZME-ZVEBFXSZSA-N.
| Molecular formula | C6H15N |
|---|---|
| Molecular weight | 115.28 g/mol |
| IUPAC name | 1,1,1,2,3,3,3-heptadeuterio-N-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)propan-2-amine |
| InChIKey | UAOMVDZJSHZZME-ZVEBFXSZSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])NC([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)