CAS 70237-42-2 is the registry number for 2-Diisopropylaminoethanol-D14. Offered by: TRC. Available pack sizes: 250mg.
2-[bis(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)amino]ethanol (CAS 70237-42-2) is a chemical compound with the molecular formula C8H19NO and a molecular weight of 159.33 g/mol. IUPAC name: 2-[bis(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)amino]ethanol. InChIKey: ZYWUVGFIXPNBDL-GLHILRGCSA-N.
| Molecular formula | C8H19NO |
|---|---|
| Molecular weight | 159.33 g/mol |
| IUPAC name | 2-[bis(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)amino]ethanol |
| InChIKey | ZYWUVGFIXPNBDL-GLHILRGCSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])N(CCO)C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)