CAS 7025-33-4 appears in our catalog under these names: 2-(4-Bromophenyl)benzo[d]imidazo[2,1-b]thiazole, 95%, 95%, 2-(4-Bromo-phenyl)-benzo[d]imidazo[2,1-b]thiazole, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-(4-bromophenyl)imidazo[2,1-b][1,3]benzothiazole (CAS 7025-33-4) is a chemical compound with the molecular formula C15H9BrN2S and a molecular weight of 329.2 g/mol. IUPAC name: 2-(4-bromophenyl)imidazo[2,1-b][1,3]benzothiazole. InChIKey: KEPQCZGPWRNPCZ-UHFFFAOYSA-N.
| Molecular formula | C15H9BrN2S |
|---|---|
| Molecular weight | 329.2 g/mol |
| IUPAC name | 2-(4-bromophenyl)imidazo[2,1-b][1,3]benzothiazole |
| InChIKey | KEPQCZGPWRNPCZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N3C=C(N=C3S2)C4=CC=C(C=C4)Br |
Computed by PubChem (NCBI)