CAS 70253-67-7 appears in our catalog under these names: N6-Monobutyryladenosine 3':5'-Cyclic Monophosphate Sodium Salt, >95% (HPLC), N6–Monobutyryladenosine 3′:5′–cyclic monophosphate sodium salt, 6-MB-cAMP. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 1 mg, 5 mg.
CAS 70253-67-7 identifies a chemical compound with the molecular formula C14H18N5NaO7P and a molecular weight of 422.29 g/mol. InChIKey: UVMXPHRDUKTUCH-UHFFFAOYSA-N.
| Molecular formula | C14H18N5NaO7P |
|---|---|
| Molecular weight | 422.29 g/mol |
| InChIKey | UVMXPHRDUKTUCH-UHFFFAOYSA-N |
| SMILES | CCCC(=O)NC1=C2C(=NC=N1)N(C=N2)C3C(C4C(O3)COP(=O)(O4)O)O.[Na] |
Computed by PubChem (NCBI)