CAS 70255-70-8 is the registry number for Methyl 6-amino-9-β-D-ribofuranosyl-9H-purine-2-carboxylate. Offered by: MedChemExpress. Available pack sizes: Get quote.
Methyl 6-amino-9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purine-2-carboxylate (CAS 70255-70-8) is a chemical compound with the molecular formula C12H15N5O6 and a molecular weight of 325.28 g/mol. IUPAC name: methyl 6-amino-9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purine-2-carboxylate. InChIKey: SUQFETLCLGLIGW-UHFFFAOYSA-N.
| Molecular formula | C12H15N5O6 |
|---|---|
| Molecular weight | 325.28 g/mol |
| IUPAC name | methyl 6-amino-9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purine-2-carboxylate |
| InChIKey | SUQFETLCLGLIGW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC(=C2C(=N1)N(C=N2)C3C(C(C(O3)CO)O)O)N |
Computed by PubChem (NCBI)