CAS 702666-73-7 is the registry number for tert-butyl (1R,4S)-2-azabicyclo[2.2.1]hept-5-ene-2-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
Tert-butyl (1R,4S)-2-azabicyclo[2.2.1]hept-5-ene-2-carboxylate (CAS 702666-73-7) is a chemical compound with the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. IUPAC name: tert-butyl (1R,4S)-2-azabicyclo[2.2.1]hept-5-ene-2-carboxylate. InChIKey: ZATXHTCUZAWODK-BDAKNGLRSA-N.
| Molecular formula | C11H17NO2 |
|---|---|
| Molecular weight | 195.26 g/mol |
| IUPAC name | tert-butyl (1R,4S)-2-azabicyclo[2.2.1]hept-5-ene-2-carboxylate |
| InChIKey | ZATXHTCUZAWODK-BDAKNGLRSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2C[C@@H]1C=C2 |
Computed by PubChem (NCBI)