Products 702680-17-9
CAS 702680-17-9 appears in our catalog under these names: CP-775146, CP 775146, CP 775146, CP-775146, 98.70%. Offered by: TRC, TargetMol, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1mg, 2,5mg, 50mg, 1 mg, 5 mg.
2-methyl-2-[3-[(3S)-1-[2-(4-propan-2-ylphenyl)acetyl]piperidin-3-yl]phenoxy]propanoic acid (CAS 702680-17-9) is a chemical compound with the molecular formula C26H33NO4 and a molecular weight of 423.5 g/mol. IUPAC name: 2-methyl-2-[3-[(3S)-1-[2-(4-propan-2-ylphenyl)acetyl]piperidin-3-yl]phenoxy]propanoic acid. InChIKey: OISHBINQIFNIPV-JOCHJYFZSA-N.
| Molecular formula | C26H33NO4 |
|---|---|
| Molecular weight | 423.5 g/mol |
| IUPAC name | 2-methyl-2-[3-[(3S)-1-[2-(4-propan-2-ylphenyl)acetyl]piperidin-3-yl]phenoxy]propanoic acid |
| InChIKey | OISHBINQIFNIPV-JOCHJYFZSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)CC(=O)N2CCC[C@H](C2)C3=CC(=CC=C3)OC(C)(C)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
orb1704598