CAS 70274-89-4 appears in our catalog under these names: H-Arg-AMC, H–Arg–AMC, H-Arg-AMC hydrochloride. Offered by: Creative Peptides, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 100mg, 50mg.
(2S)-2-amino-5-(diaminomethylideneamino)-N-(4-methyl-2-oxochromen-7-yl)pentanamide (CAS 70274-89-4) is a chemical compound with the molecular formula C16H21N5O3 and a molecular weight of 331.37 g/mol. IUPAC name: (2S)-2-amino-5-(diaminomethylideneamino)-N-(4-methyl-2-oxochromen-7-yl)pentanamide. InChIKey: ZSQPDAOJXSYJNP-LBPRGKRZSA-N.
| Molecular formula | C16H21N5O3 |
|---|---|
| Molecular weight | 331.37 g/mol |
| IUPAC name | (2S)-2-amino-5-(diaminomethylideneamino)-N-(4-methyl-2-oxochromen-7-yl)pentanamide |
| InChIKey | ZSQPDAOJXSYJNP-LBPRGKRZSA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)NC(=O)[C@H](CCCN=C(N)N)N |
Computed by PubChem (NCBI)