CAS 70277-02-0 appears in our catalog under these names: 3-Iodo-l-tyrosine methyl ester, 96%, (S)-Methyl 2-amino-3-(4-hydroxy-3-iodophenyl)propanoate, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
Methyl (2S)-2-amino-3-(4-hydroxy-3-iodophenyl)propanoate (CAS 70277-02-0) is a chemical compound with the molecular formula C10H12INO3 and a molecular weight of 321.11 g/mol. IUPAC name: methyl (2S)-2-amino-3-(4-hydroxy-3-iodophenyl)propanoate. InChIKey: MBOJFMMTOKMYMT-QMMMGPOBSA-N.
| Molecular formula | C10H12INO3 |
|---|---|
| Molecular weight | 321.11 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-(4-hydroxy-3-iodophenyl)propanoate |
| InChIKey | MBOJFMMTOKMYMT-QMMMGPOBSA-N |
| SMILES | COC(=O)[C@H](CC1=CC(=C(C=C1)O)I)N |
Computed by PubChem (NCBI)