CAS 70331-82-7 appears in our catalog under these names: N-Tris(hydroxymethyl)methyl-2-aminoethanesulfonic acid sodium salt hydrate, 95%, Tes sodium salt, 98%, TES sodium, TES, 0.2M buffer soln., pH 7.5 , TES sodium salt . Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Chemat, MedChemExpress. Available pack sizes: 25g, 100g, 1g, 5g, 100ml, 250ml, 250g, 500g.
Sodium 2-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]ethanesulfonate (CAS 70331-82-7) is a chemical compound with the molecular formula C6H14NNaO6S and a molecular weight of 251.24 g/mol. IUPAC name: sodium 2-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]ethanesulfonate. InChIKey: GUXMFAHOYNRHBI-UHFFFAOYSA-M.
| Molecular formula | C6H14NNaO6S |
|---|---|
| Molecular weight | 251.24 g/mol |
| IUPAC name | sodium 2-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]ethanesulfonate |
| InChIKey | GUXMFAHOYNRHBI-UHFFFAOYSA-M |
| SMILES | C(CS(=O)(=O)[O-])NC(CO)(CO)CO.[Na+] |
Computed by PubChem (NCBI)