CAS 70335-40-9 appears in our catalog under these names: 2-Bromo-4-(chloromethyl)-1,3,5-trimethylbenzene 95%, 2-Bromo-4-(chloromethyl)-1,3,5-trimethylbenzene, 95%, 95%, 2-Bromo-4-(chloromethyl)-1,3,5-trimethylbenzene, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-bromo-4-(chloromethyl)-1,3,5-trimethylbenzene (CAS 70335-40-9) is a chemical compound with the molecular formula C10H12BrCl and a molecular weight of 247.56 g/mol. IUPAC name: 2-bromo-4-(chloromethyl)-1,3,5-trimethylbenzene. InChIKey: LSEDHNDZISRJSQ-UHFFFAOYSA-N.
| Molecular formula | C10H12BrCl |
|---|---|
| Molecular weight | 247.56 g/mol |
| IUPAC name | 2-bromo-4-(chloromethyl)-1,3,5-trimethylbenzene |
| InChIKey | LSEDHNDZISRJSQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1CCl)C)Br)C |
Computed by PubChem (NCBI)