CAS 70352-20-4 appears in our catalog under these names: P-septiphenyl, 98%, Poly(2,5-bisoctyloxy)-1,4-phenylenevinylene). Offered by: Chemat Brand, Lumtec. Available pack sizes: on request.
1,4-bis[4-(4-phenylphenyl)phenyl]benzene (CAS 70352-20-4) is a chemical compound with the molecular formula C42H30 and a molecular weight of 534.7 g/mol. IUPAC name: 1,4-bis[4-(4-phenylphenyl)phenyl]benzene. InChIKey: QCBOFBWUYYECLN-UHFFFAOYSA-N.
| Molecular formula | C42H30 |
|---|---|
| Molecular weight | 534.7 g/mol |
| IUPAC name | 1,4-bis[4-(4-phenylphenyl)phenyl]benzene |
| InChIKey | QCBOFBWUYYECLN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=CC=C(C=C3)C4=CC=C(C=C4)C5=CC=C(C=C5)C6=CC=C(C=C6)C7=CC=CC=C7 |
Computed by PubChem (NCBI)