Products 70356-03-5
CAS 70356-03-5 appears in our catalog under these names: Cefaclor monohydrate, 98%, Cefaclor Monohydrate, Cefaclor Monohydrate, >95% (HPLC), Cefaclor Hydrate, >95% (HPLC), Cefaclor monohydrate/ 99.48% (existing batch purity). Offered by: Combi-blocks, Mikromol, LoGiCal, TRC, TargetMol. Available pack sizes: 100g, 10g, 25g, 5g, 1g, 100mg, 10mg, 250mg.
(6R,7R)-7-[[(2R)-2-amino-2-phenylacetyl]amino]-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;hydrate (CAS 70356-03-5) is a chemical compound with the molecular formula C15H16ClN3O5S and a molecular weight of 385.8 g/mol. IUPAC name: (6R,7R)-7-[[(2R)-2-amino-2-phenylacetyl]amino]-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;hydrate. InChIKey: WKJGTOYAEQDNIA-IOOZKYRYSA-N.
| Molecular formula | C15H16ClN3O5S |
|---|---|
| Molecular weight | 385.8 g/mol |
| IUPAC name | (6R,7R)-7-[[(2R)-2-amino-2-phenylacetyl]amino]-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;hydrate |
| InChIKey | WKJGTOYAEQDNIA-IOOZKYRYSA-N |
| SMILES | C1C(=C(N2[C@H](S1)[C@@H](C2=O)NC(=O)[C@@H](C3=CC=CC=C3)N)C(=O)O)Cl.O |
Computed by PubChem (NCBI)