CAS 70380-50-6 appears in our catalog under these names: Anagrelide Impurity 1 HCl, Anagrelide Impurity 24. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-[(2,3-dichloro-6-nitrophenyl)methylamino]acetate;hydrochloride (CAS 70380-50-6) is a chemical compound with the molecular formula C11H13Cl3N2O4 and a molecular weight of 343.6 g/mol. IUPAC name: ethyl 2-[(2,3-dichloro-6-nitrophenyl)methylamino]acetate;hydrochloride. InChIKey: OUUNBAYMSDWITP-UHFFFAOYSA-N.
| Molecular formula | C11H13Cl3N2O4 |
|---|---|
| Molecular weight | 343.6 g/mol |
| IUPAC name | ethyl 2-[(2,3-dichloro-6-nitrophenyl)methylamino]acetate;hydrochloride |
| InChIKey | OUUNBAYMSDWITP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CNCC1=C(C=CC(=C1Cl)Cl)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)