CAS 70404-23-8 is the registry number for 7-Benzyl-8-bromo-1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-benzyl-8-bromo-1,3-dimethylpurine-2,6-dione (CAS 70404-23-8) is a chemical compound with the molecular formula C14H13BrN4O2 and a molecular weight of 349.18 g/mol. IUPAC name: 7-benzyl-8-bromo-1,3-dimethylpurine-2,6-dione. InChIKey: ZFIXVNHJYVUKFY-UHFFFAOYSA-N.
| Molecular formula | C14H13BrN4O2 |
|---|---|
| Molecular weight | 349.18 g/mol |
| IUPAC name | 7-benzyl-8-bromo-1,3-dimethylpurine-2,6-dione |
| InChIKey | ZFIXVNHJYVUKFY-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=O)N(C1=O)C)N(C(=N2)Br)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)