Products 70434-49-0

CAS 70434-49-0 is the registry number for CP-47947 Benzyl Ether. Offered by: TRC, Biosynth. Available pack sizes: 2,5mg, 25mg, 5mg, 10mg, 50mg.

Structural formula: {0} (CAS {1})

Cis-(1S,3R)-3-[4-(2-methyloctan-2-yl)-2-phenylmethoxyphenyl]cyclohexan-1-ol (CAS 70434-49-0) is a chemical compound with the molecular formula C28H40O2 and a molecular weight of 408.6 g/mol. IUPAC name: cis-(1S,3R)-3-[4-(2-methyloctan-2-yl)-2-phenylmethoxyphenyl]cyclohexan-1-ol. InChIKey: XLRWCRGAMYGBSU-NOZRDPDXSA-N.

Identity
Molecular formulaC28H40O2
Molecular weight408.6 g/mol
IUPAC namecis-(1S,3R)-3-[4-(2-methyloctan-2-yl)-2-phenylmethoxyphenyl]cyclohexan-1-ol
InChIKeyXLRWCRGAMYGBSU-NOZRDPDXSA-N
SMILESCCCCCCC(C)(C)C1=CC(=C(C=C1)[C@@H]2CCC[C@@H](C2)O)OCC3=CC=CC=C3

Computed by PubChem (NCBI)