CAS 70442-23-8 appears in our catalog under these names: D-Glucosamine 6-phosphate sodium salt, 95%, Sodium (2R,3S,4R,5R)-5-amino-2,3,4-trihydroxy-6-oxohexyl phosphate, 98%, D–Glucosamine–6–phosphate Sodium Salt, D–Glucosamine 6–phosphate sodium, D-Glucosamine-6-phosphate sodium salt. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Sigma-Aldrich. Available pack sizes: 250mg, 1g, 100mg, 10mg, 25mg, 5mg, 500mg, 1000mg.
Sodium [(2R,3S,4R,5R)-5-amino-3,4,6-trihydroxyoxan-2-yl]methyl hydrogen phosphate (CAS 70442-23-8) is a chemical compound with the molecular formula C6H13NNaO8P and a molecular weight of 281.13 g/mol. IUPAC name: sodium [(2R,3S,4R,5R)-5-amino-3,4,6-trihydroxyoxan-2-yl]methyl hydrogen phosphate. InChIKey: ITFLGSDHWWAGKW-NSEZLWDYSA-M.
| Molecular formula | C6H13NNaO8P |
|---|---|
| Molecular weight | 281.13 g/mol |
| IUPAC name | sodium [(2R,3S,4R,5R)-5-amino-3,4,6-trihydroxyoxan-2-yl]methyl hydrogen phosphate |
| InChIKey | ITFLGSDHWWAGKW-NSEZLWDYSA-M |
| SMILES | C([C@@H]1[C@H]([C@@H]([C@H](C(O1)O)N)O)O)OP(=O)(O)[O-].[Na+] |
Computed by PubChem (NCBI)