CAS 70445-50-0 is the registry number for 1-(3,3-Diphenyl-3-hydroxypropyl)-1-methylpiperidinium iodide. Offered by: Biosynth. Available pack sizes: 50mg, 25mg, 100mg.
3-(1-methylpiperidin-1-ium-1-yl)-1,1-diphenylpropan-1-ol iodide (CAS 70445-50-0) is a chemical compound with the molecular formula C21H28INO and a molecular weight of 437.4 g/mol. IUPAC name: 3-(1-methylpiperidin-1-ium-1-yl)-1,1-diphenylpropan-1-ol iodide. InChIKey: LAGQPLMAHPNLOI-UHFFFAOYSA-M.
| Molecular formula | C21H28INO |
|---|---|
| Molecular weight | 437.4 g/mol |
| IUPAC name | 3-(1-methylpiperidin-1-ium-1-yl)-1,1-diphenylpropan-1-ol iodide |
| InChIKey | LAGQPLMAHPNLOI-UHFFFAOYSA-M |
| SMILES | C[N+]1(CCCCC1)CCC(C2=CC=CC=C2)(C3=CC=CC=C3)O.[I-] |
Computed by PubChem (NCBI)