CAS 70458-98-9 is the registry number for 1-Ethyl-6-fluoro-7-morpholin-4-yl-4-oxo-1,4-dihydroquinoline-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
1-ethyl-6-fluoro-7-morpholin-4-yl-4-oxoquinoline-3-carboxylic acid (CAS 70458-98-9) is a chemical compound with the molecular formula C16H17FN2O4 and a molecular weight of 320.31 g/mol. IUPAC name: 1-ethyl-6-fluoro-7-morpholin-4-yl-4-oxoquinoline-3-carboxylic acid. InChIKey: CWGUZPQPISQBPV-UHFFFAOYSA-N.
| Molecular formula | C16H17FN2O4 |
|---|---|
| Molecular weight | 320.31 g/mol |
| IUPAC name | 1-ethyl-6-fluoro-7-morpholin-4-yl-4-oxoquinoline-3-carboxylic acid |
| InChIKey | CWGUZPQPISQBPV-UHFFFAOYSA-N |
| SMILES | CCN1C=C(C(=O)C2=CC(=C(C=C21)N3CCOCC3)F)C(=O)O |
Computed by PubChem (NCBI)