CAS 70459-07-3 appears in our catalog under these names: Norfloxacin EP Impurity K, Norfloxacin Impurity K 95%, 6-Fluoro-1-methyl-4-oxo-7-(piperazin-1-yl)-1,4-dihydroquinoline-3-carboxylic acid, 95%, 95%. Offered by: Chemat Brand, Ambeed, Chemat. Available pack sizes: on request, 50mg, 100mg, 250mg, 1g, 5g.
6-fluoro-1-methyl-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid (CAS 70459-07-3) is a chemical compound with the molecular formula C15H16FN3O3 and a molecular weight of 305.30 g/mol. IUPAC name: 6-fluoro-1-methyl-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid. InChIKey: RJWWSGDZPMTGGM-UHFFFAOYSA-N.
| Molecular formula | C15H16FN3O3 |
|---|---|
| Molecular weight | 305.30 g/mol |
| IUPAC name | 6-fluoro-1-methyl-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid |
| InChIKey | RJWWSGDZPMTGGM-UHFFFAOYSA-N |
| SMILES | CN1C=C(C(=O)C2=CC(=C(C=C21)N3CCNCC3)F)C(=O)O |
Computed by PubChem (NCBI)