CAS 70460-45-6 is the registry number for MRS1067. Offered by: MedChemExpress. Available pack sizes: Get quote.
3,6-dichloro-2-(4-methyl-2-propan-2-yloxyphenyl)chromen-4-one (CAS 70460-45-6) is a chemical compound with the molecular formula C19H16Cl2O3 and a molecular weight of 363.2 g/mol. IUPAC name: 3,6-dichloro-2-(4-methyl-2-propan-2-yloxyphenyl)chromen-4-one. InChIKey: PWGZOUCWGRTPSM-UHFFFAOYSA-N.
| Molecular formula | C19H16Cl2O3 |
|---|---|
| Molecular weight | 363.2 g/mol |
| IUPAC name | 3,6-dichloro-2-(4-methyl-2-propan-2-yloxyphenyl)chromen-4-one |
| InChIKey | PWGZOUCWGRTPSM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C2=C(C(=O)C3=C(O2)C=CC(=C3)Cl)Cl)OC(C)C |
Computed by PubChem (NCBI)