Products 70476-08-3

CAS 70476-08-3 is the registry number for Thiamine Impurity 18 HCl. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-(chloromethyl)-2-methylpyrimidin-4-amine;hydrochloride (CAS 70476-08-3) is a chemical compound with the molecular formula C6H9Cl2N3 and a molecular weight of 194.06 g/mol. IUPAC name: 5-(chloromethyl)-2-methylpyrimidin-4-amine;hydrochloride. InChIKey: IUICOFBIOJSLTA-UHFFFAOYSA-N.

Identity
Molecular formulaC6H9Cl2N3
Molecular weight194.06 g/mol
IUPAC name5-(chloromethyl)-2-methylpyrimidin-4-amine;hydrochloride
InChIKeyIUICOFBIOJSLTA-UHFFFAOYSA-N
SMILESCC1=NC=C(C(=N1)N)CCl.Cl

Computed by PubChem (NCBI)