CAS 704910-89-4 appears in our catalog under these names: 4-Desmethoxy omeprazole sulfide, Omeprazole Impurity 11, Esomeprazole Impurity 29, 5-Methoxy-2-(((3,5-dimethylpyridin-2-yl)methyl)sulphanyl)-1H-benzimidazole. Offered by: Biosynth, Chemat Brand, Hubei YoungXin, Mikromol. Available pack sizes: 500mg, 250mg, 1000mg, 5000mg, 2000mg, on request, 10mg, 25mg.
2-[(3,5-dimethyl-2-pyridinyl)methylsulfanyl]-6-methoxy-1H-benzimidazole (CAS 704910-89-4) is a chemical compound with the molecular formula C16H17N3OS and a molecular weight of 299.4 g/mol. IUPAC name: 2-[(3,5-dimethyl-2-pyridinyl)methylsulfanyl]-6-methoxy-1H-benzimidazole. InChIKey: YTUHHMNQRUNZTP-UHFFFAOYSA-N.
| Molecular formula | C16H17N3OS |
|---|---|
| Molecular weight | 299.4 g/mol |
| IUPAC name | 2-[(3,5-dimethyl-2-pyridinyl)methylsulfanyl]-6-methoxy-1H-benzimidazole |
| InChIKey | YTUHHMNQRUNZTP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N=C1)CSC2=NC3=C(N2)C=C(C=C3)OC)C |
Computed by PubChem (NCBI)