CAS 70496-34-3 appears in our catalog under these names: Propionylthiocholine chloride, 95%, N,N,N–trimethyl–2–(propionylthio)ethan–1–aminium chloride, S-Propionylthiocholine chloride. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 250mg, 10g, 5g, 1g, 2000mg, 5000mg, 10000mg.
Trimethyl(2-propanoylsulfanylethyl)azanium chloride (CAS 70496-34-3) is a chemical compound with the molecular formula C8H18ClNOS and a molecular weight of 211.75 g/mol. IUPAC name: trimethyl(2-propanoylsulfanylethyl)azanium chloride. InChIKey: DFQTUNIXEAAEKC-UHFFFAOYSA-M.
| Molecular formula | C8H18ClNOS |
|---|---|
| Molecular weight | 211.75 g/mol |
| IUPAC name | trimethyl(2-propanoylsulfanylethyl)azanium chloride |
| InChIKey | DFQTUNIXEAAEKC-UHFFFAOYSA-M |
| SMILES | CCC(=O)SCC[N+](C)(C)C.[Cl-] |
Computed by PubChem (NCBI)