Products 70519-72-1

CAS 70519-72-1 is the registry number for 2-[(1,1-Dioxidotetrahydro-3-thienyl)amino]ethanol hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 50g, 5g, 1g.

Structural formula: {0} (CAS {1})

2-[(1,1-dioxothiolan-3-yl)amino]ethanol;hydrochloride (CAS 70519-72-1) is a chemical compound with the molecular formula C6H14ClNO3S and a molecular weight of 215.70 g/mol. IUPAC name: 2-[(1,1-dioxothiolan-3-yl)amino]ethanol;hydrochloride. InChIKey: DVLLSFLKNWESFH-UHFFFAOYSA-N.

Identity
Molecular formulaC6H14ClNO3S
Molecular weight215.70 g/mol
IUPAC name2-[(1,1-dioxothiolan-3-yl)amino]ethanol;hydrochloride
InChIKeyDVLLSFLKNWESFH-UHFFFAOYSA-N
SMILESC1CS(=O)(=O)CC1NCCO.Cl

Computed by PubChem (NCBI)