CAS 7052-21-3 is the registry number for Ethyl 4-amino-3-methyl-2-sulfanylidene-2,3-dihydro-1,3-thiazole-5-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Ethyl 4-amino-3-methyl-2-sulfanylidene-1,3-thiazole-5-carboxylate (CAS 7052-21-3) is a chemical compound with the molecular formula C7H10N2O2S2 and a molecular weight of 218.3 g/mol. IUPAC name: ethyl 4-amino-3-methyl-2-sulfanylidene-1,3-thiazole-5-carboxylate. InChIKey: ZEAFXGPUYCXZCM-UHFFFAOYSA-N.
| Molecular formula | C7H10N2O2S2 |
|---|---|
| Molecular weight | 218.3 g/mol |
| IUPAC name | ethyl 4-amino-3-methyl-2-sulfanylidene-1,3-thiazole-5-carboxylate |
| InChIKey | ZEAFXGPUYCXZCM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(C(=S)S1)C)N |
Computed by PubChem (NCBI)