CAS 70523-24-9 appears in our catalog under these names: 2,4-Bis(benzyloxy)pyrimidine-5-boronic acid, 95%, 2,4–Dibenzyloxypyrimidine–5–boronic acid (contains varying amounts of Anhydride), 2,4-Bis(benzyloxy)pyrimidin-5-ylboronic acid 98%, 2,4-Bis(benzyloxy)pyrimidin-5-ylboronic acid, 98%, 98%, 2,4-BIS(BENZYLOXY)PYRIMIDINE-5-BORONIC ACID, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g, 25g.
[2,4-bis(phenylmethoxy)pyrimidin-5-yl]boronic acid (CAS 70523-24-9) is a chemical compound with the molecular formula C18H17BN2O4 and a molecular weight of 336.2 g/mol. IUPAC name: [2,4-bis(phenylmethoxy)pyrimidin-5-yl]boronic acid. InChIKey: HVVGEQHZGHNHJD-UHFFFAOYSA-N.
| Molecular formula | C18H17BN2O4 |
|---|---|
| Molecular weight | 336.2 g/mol |
| IUPAC name | [2,4-bis(phenylmethoxy)pyrimidin-5-yl]boronic acid |
| InChIKey | HVVGEQHZGHNHJD-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(N=C1OCC2=CC=CC=C2)OCC3=CC=CC=C3)(O)O |
Computed by PubChem (NCBI)