CAS 705250-95-9 is the registry number for Trans-2-(3,5-difluorophenyl)cyclopropan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Trans-(1R,2S)-2-(3,5-difluorophenyl)cyclopropan-1-amine (CAS 705250-95-9) is a chemical compound with the molecular formula C9H9F2N and a molecular weight of 169.17 g/mol. IUPAC name: trans-(1R,2S)-2-(3,5-difluorophenyl)cyclopropan-1-amine. InChIKey: XLQLRKKOZIANSJ-DTWKUNHWSA-N.
| Molecular formula | C9H9F2N |
|---|---|
| Molecular weight | 169.17 g/mol |
| IUPAC name | trans-(1R,2S)-2-(3,5-difluorophenyl)cyclopropan-1-amine |
| InChIKey | XLQLRKKOZIANSJ-DTWKUNHWSA-N |
| SMILES | C1[C@H]([C@@H]1N)C2=CC(=CC(=C2)F)F |
Computed by PubChem (NCBI)