Products 70528-90-4
CAS 70528-90-4 is the registry number for Disperse yellow 211. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-[(4-chloro-2-nitrophenyl)diazenyl]-1-ethyl-2-hydroxy-4-methyl-6-oxopyridine-3-carbonitrile (CAS 70528-90-4) is a chemical compound with the molecular formula C15H12ClN5O4 and a molecular weight of 361.74 g/mol. IUPAC name: 5-[(4-chloro-2-nitrophenyl)diazenyl]-1-ethyl-2-hydroxy-4-methyl-6-oxopyridine-3-carbonitrile. InChIKey: FHERFUXQYBSNRD-UHFFFAOYSA-N.
| Molecular formula | C15H12ClN5O4 |
|---|---|
| Molecular weight | 361.74 g/mol |
| IUPAC name | 5-[(4-chloro-2-nitrophenyl)diazenyl]-1-ethyl-2-hydroxy-4-methyl-6-oxopyridine-3-carbonitrile |
| InChIKey | FHERFUXQYBSNRD-UHFFFAOYSA-N |
| SMILES | CCN1C(=C(C(=C(C1=O)N=NC2=C(C=C(C=C2)Cl)[N+](=O)[O-])C)C#N)O |
Computed by PubChem (NCBI)