CAS 70529-35-0 is the registry number for Itazigrel. Offered by: MedChemExpress. Available pack sizes: Get quote.
4,5-bis(4-methoxyphenyl)-2-(trifluoromethyl)-1,3-thiazole (CAS 70529-35-0) is a chemical compound with the molecular formula C18H14F3NO2S and a molecular weight of 365.4 g/mol. IUPAC name: 4,5-bis(4-methoxyphenyl)-2-(trifluoromethyl)-1,3-thiazole. InChIKey: CIPBQTCSXVEDSG-UHFFFAOYSA-N.
| Molecular formula | C18H14F3NO2S |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | 4,5-bis(4-methoxyphenyl)-2-(trifluoromethyl)-1,3-thiazole |
| InChIKey | CIPBQTCSXVEDSG-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=C(SC(=N2)C(F)(F)F)C3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)