CAS 70553-61-6 is the registry number for 1,3-Bis(6-methyl-1H-benzo[d]imidazol-2-yl)benzene, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-methyl-2-[3-(6-methyl-1H-benzimidazol-2-yl)phenyl]-1H-benzimidazole (CAS 70553-61-6) is a chemical compound with the molecular formula C22H18N4 and a molecular weight of 338.4 g/mol. IUPAC name: 6-methyl-2-[3-(6-methyl-1H-benzimidazol-2-yl)phenyl]-1H-benzimidazole. InChIKey: MTIFWVGUKAUNJM-UHFFFAOYSA-N.
| Molecular formula | C22H18N4 |
|---|---|
| Molecular weight | 338.4 g/mol |
| IUPAC name | 6-methyl-2-[3-(6-methyl-1H-benzimidazol-2-yl)phenyl]-1H-benzimidazole |
| InChIKey | MTIFWVGUKAUNJM-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N=C(N2)C3=CC(=CC=C3)C4=NC5=C(N4)C=C(C=C5)C |
Computed by PubChem (NCBI)