CAS 70564-92-0 appears in our catalog under these names: 4-Bromo-3,5-dimethylpyridine 1-oxide, 97%, 4-Bromo-3,5-dimethylpyridine 1-oxide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-bromo-3,5-dimethyl-1-oxidopyridin-1-ium (CAS 70564-92-0) is a chemical compound with the molecular formula C7H8BrNO and a molecular weight of 202.05 g/mol. IUPAC name: 4-bromo-3,5-dimethyl-1-oxidopyridin-1-ium. InChIKey: SNKJRMVWDYSVHC-UHFFFAOYSA-N.
| Molecular formula | C7H8BrNO |
|---|---|
| Molecular weight | 202.05 g/mol |
| IUPAC name | 4-bromo-3,5-dimethyl-1-oxidopyridin-1-ium |
| InChIKey | SNKJRMVWDYSVHC-UHFFFAOYSA-N |
| SMILES | CC1=C[N+](=CC(=C1Br)C)[O-] |
Computed by PubChem (NCBI)