CAS 7059-70-3 appears in our catalog under these names: 1,3,5-Tri(1-naphthyl)benzene, 95%, 1,3,5-Tri(1-naphthyl)benzene, 1,3,5–Tri(1–naphthyl)benzene, 1,3,5-Tri(1-naphthyl)benzene, >98.0%(HPLC), 1,3,5-Tri(naphthalen-1-yl)benzene 98%. Offered by: Combi-blocks, TRC, GLPBio, TCI, Ambeed. Available pack sizes: 250mg, 1g, 100mg, 10mg, 50mg, 5g, 200mg, 10g.
1-(3,5-dinaphthalen-1-ylphenyl)naphthalene (CAS 7059-70-3) is a chemical compound with the molecular formula C36H24 and a molecular weight of 456.6 g/mol. IUPAC name: 1-(3,5-dinaphthalen-1-ylphenyl)naphthalene. InChIKey: ZVUZLHDATWCFQW-UHFFFAOYSA-N.
| Molecular formula | C36H24 |
|---|---|
| Molecular weight | 456.6 g/mol |
| IUPAC name | 1-(3,5-dinaphthalen-1-ylphenyl)naphthalene |
| InChIKey | ZVUZLHDATWCFQW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C3=CC(=CC(=C3)C4=CC=CC5=CC=CC=C54)C6=CC=CC7=CC=CC=C76 |
Computed by PubChem (NCBI)